C15H26N2OS — CID 3738612
1-(2-thiophen-2-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 3738612) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-(2-thiophen-2-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 3738612 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-(2-thiophen-2-ylethyl)-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C15H26N2OS/c1-14(2,3)11-15(4,5)17-13(18)16-9-8-12-7-6-10-19-12/h6-7,10H,8-9,11H2,1-5H3,(H2,16,17,18) |
| InChIKey | ZUZSXHKGAVZKLS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |