C26H23F3N6O — CID 3738711
1-benzyl-3-[4-(dibenzylamino)-6-(trifluoromethyl)-1,3,5-triazin-2-yl]urea (PubChem CID 3738711) has the molecular formula C26H23F3N6O and a molecular weight of 492.51 g/mol. Its IUPAC name is 1-benzyl-3-[4-(dibenzylamino)-6-(trifluoromethyl)-1,3,5-triazin-2-yl]urea.
| Compound Name | 1-benzyl-3-[4-(dibenzylamino)-6-(trifluoromethyl)-1,3,5-triazin-2-yl]urea |
|---|---|
| PubChem CID | 3738711 |
| Molecular Formula | C26H23F3N6O |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1-benzyl-3-[4-(dibenzylamino)-6-(trifluoromethyl)-1,3,5-triazin-2-yl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1nc(N(Cc2ccccc2)Cc2ccccc2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C26H23F3N6O/c27-26(28,29)22-31-23(34-25(36)30-16-19-10-4-1-5-11-19)33-24(32-22)35(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15H,16-18H2,(H2,30,31,32,33,34,36) |
| InChIKey | LRHRWSWTBQIEET-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |