About tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate
tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate (PubChem CID 3738801) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate |
| PubChem CID | 3738801 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate |
| SMILES | CN(C)C=Nc1ncc(C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C11H17N3O2S/c1-11(2,3)16-9(15)8-6-12-10(17-8)13-7-14(4)5/h6-7H,1-5H3 |
| InChIKey | POLKYAGDNCXWDC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate?
The IUPAC name of tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate (CID 3738801) is tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate?
The canonical SMILES for tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate is CN(C)C=Nc1ncc(C(=O)OC(C)(C)C)s1.
What is the InChIKey of tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate?
The InChIKey is POLKYAGDNCXWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S/c1-11(2,3)16-9(15)8-6-12-10(17-8)13-7-14(4)5/h6-7H,1-5H3.
What are the key properties of tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate?
tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate has a molecular weight of 255.34 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(dimethylaminomethylideneamino)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 3738801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).