C13H10F2N2O2 — CID 37391009
N-[(3,5-difluorophenyl)methyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 37391009) has the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 37391009 |
| Molecular Formula | C13H10F2N2O2 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(F)c1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C13H10F2N2O2/c14-9-4-8(5-10(15)6-9)7-17-13(19)11-2-1-3-16-12(11)18/h1-6H,7H2,(H,16,18)(H,17,19) |
| InChIKey | YYUKTLLGVUHGPZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |