C25H32N4O4S — CID 37393401
2-[4-[methyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]-N-(3-pyrazol-1-ylpropyl)acetamide (PubChem CID 37393401) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-[4-[methyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]-N-(3-pyrazol-1-ylpropyl)acetamide.
| Compound Name | 2-[4-[methyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]-N-(3-pyrazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 37393401 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-[4-[methyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]phenoxy]-N-(3-pyrazol-1-ylpropyl)acetamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N(C)c2ccc(OCC(=O)NCCCn3cccn3)cc2)c1C |
| InChI | InChI=1S/C25H32N4O4S/c1-18-16-19(2)21(4)25(20(18)3)34(31,32)28(5)22-8-10-23(11-9-22)33-17-24(30)26-12-6-14-29-15-7-13-27-29/h7-11,13,15-16H,6,12,14,17H2,1-5H3,(H,26,30) |
| InChIKey | OOBFWACYBZFNBF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|