C27H29NO12 — CID 3739903
methyl 2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoate (PubChem CID 3739903) has the molecular formula C27H29NO12 and a molecular weight of 559.52 g/mol. Its IUPAC name is methyl 2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 3739903 |
| Molecular Formula | C27H29NO12 |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | methyl 2-[[6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)C1OC(Oc2cc3oc(-c4ccccc4)cc(=O)c3c(O)c2O)C(O)C(O)C1O)C(C)C |
| InChI | InChI=1S/C27H29NO12/c1-11(2)18(26(36)37-3)28-25(35)24-22(33)21(32)23(34)27(40-24)39-16-10-15-17(20(31)19(16)30)13(29)9-14(38-15)12-7-5-4-6-8-12/h4-11,18,21-24,27,30-34H,1-3H3,(H,28,35) |
| InChIKey | WKBWYWJYOAONEI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 205.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|