C21H19N3O8 — CID 3739993
1-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-N-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 3739993) has the molecular formula C21H19N3O8 and a molecular weight of 441.40 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-N-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 1-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-N-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3739993 |
| Molecular Formula | C21H19N3O8 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-N-(4-nitrophenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2N1C(=O)CCC1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19N3O8/c1-30-15-9-7-13-17(18(15)31-2)21(27)32-20(13)23-14(8-10-16(23)25)19(26)22-11-3-5-12(6-4-11)24(28)29/h3-7,9,14,20H,8,10H2,1-2H3,(H,22,26) |
| InChIKey | LNDSJUMMDMFPKA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|