About 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one
7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one (PubChem CID 3740036) has the molecular formula C6H4N4O3
and a molecular weight of 180.12 g/mol. Its IUPAC name is 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one |
| PubChem CID | 3740036 |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one |
| SMILES | O=c1[nH]cc([N+](=O)[O-])c2nc[nH]c12 |
| InChI | InChI=1S/C6H4N4O3/c11-6-5-4(8-2-9-5)3(1-7-6)10(12)13/h1-2H,(H,7,11)(H,8,9) |
| InChIKey | UPBLMGMIIRGNIK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
The IUPAC name of 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one (CID 3740036) is 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one.
What is the SMILES notation for 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
The canonical SMILES for 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one is O=c1[nH]cc([N+](=O)[O-])c2nc[nH]c12.
What is the InChIKey of 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
The InChIKey is UPBLMGMIIRGNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O3/c11-6-5-4(8-2-9-5)3(1-7-6)10(12)13/h1-2H,(H,7,11)(H,8,9).
What are the key properties of 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one?
7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one has a molecular weight of 180.12 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitro-3,5-dihydroimidazo[4,5-c]pyridin-4-one is sourced from PubChem (CID 3740036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).