About [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium
[4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 3740040) has the molecular formula C19H18N3+
and a molecular weight of 288.37 g/mol. Its IUPAC name is [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
Molecular Properties
| Compound Name | [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| PubChem CID | 3740040 |
| Molecular Formula | C19H18N3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | Nc1ccc(C(=C2C=CC(=[NH2+])C=C2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C19H17N3/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,20H,21-22H2/p+1 |
| InChIKey | AFAIELJLZYUNPW-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium?
The IUPAC name of [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium (CID 3740040) is [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
What is the SMILES notation for [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium?
The canonical SMILES for [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium is Nc1ccc(C(=C2C=CC(=[NH2+])C=C2)c2ccc(N)cc2)cc1.
What is the InChIKey of [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium?
The InChIKey is AFAIELJLZYUNPW-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H17N3/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,20H,21-22H2/p+1.
What are the key properties of [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium?
[4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium has a molecular weight of 288.37 g/mol, XLogP of 1.98, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[bis(4-aminophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium is sourced from PubChem (CID 3740040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).