About 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea
1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea (PubChem CID 3740861) has the molecular formula C10H20N2O3S
and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea.
Molecular Properties
| Compound Name | 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea |
| PubChem CID | 3740861 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea |
| SMILES | CCC(C)NC(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20N2O3S/c1-4-8(2)11-9(13)12-10(3)5-6-16(14,15)7-10/h8H,4-7H2,1-3H3,(H2,11,12,13) |
| InChIKey | ONSZMORFQQIWCM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea?
The IUPAC name of 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea (CID 3740861) is 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea.
What is the SMILES notation for 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea?
The canonical SMILES for 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea is CCC(C)NC(=O)NC1(C)CCS(=O)(=O)C1.
What is the InChIKey of 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea?
The InChIKey is ONSZMORFQQIWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3S/c1-4-8(2)11-9(13)12-10(3)5-6-16(14,15)7-10/h8H,4-7H2,1-3H3,(H2,11,12,13).
What are the key properties of 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea?
1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea has a molecular weight of 248.35 g/mol, XLogP of 0.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-3-(3-methyl-1,1-dioxothiolan-3-yl)urea is sourced from PubChem (CID 3740861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).