About ethyl 2-benzamido-3,3,3-trifluoropropanoate
ethyl 2-benzamido-3,3,3-trifluoropropanoate (PubChem CID 3740884) has the molecular formula C12H12F3NO3
and a molecular weight of 275.23 g/mol. Its IUPAC name is ethyl 2-benzamido-3,3,3-trifluoropropanoate.
Molecular Properties
| Compound Name | ethyl 2-benzamido-3,3,3-trifluoropropanoate |
| PubChem CID | 3740884 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | ethyl 2-benzamido-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO3/c1-2-19-11(18)9(12(13,14)15)16-10(17)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,16,17) |
| InChIKey | OGECAYAKLYEZCM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-benzamido-3,3,3-trifluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-benzamido-3,3,3-trifluoropropanoate?
The IUPAC name of ethyl 2-benzamido-3,3,3-trifluoropropanoate (CID 3740884) is ethyl 2-benzamido-3,3,3-trifluoropropanoate.
What is the SMILES notation for ethyl 2-benzamido-3,3,3-trifluoropropanoate?
The canonical SMILES for ethyl 2-benzamido-3,3,3-trifluoropropanoate is CCOC(=O)C(NC(=O)c1ccccc1)C(F)(F)F.
What is the InChIKey of ethyl 2-benzamido-3,3,3-trifluoropropanoate?
The InChIKey is OGECAYAKLYEZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO3/c1-2-19-11(18)9(12(13,14)15)16-10(17)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,16,17).
What are the key properties of ethyl 2-benzamido-3,3,3-trifluoropropanoate?
ethyl 2-benzamido-3,3,3-trifluoropropanoate has a molecular weight of 275.23 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-benzamido-3,3,3-trifluoropropanoate is sourced from PubChem (CID 3740884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).