C12H12ClN3O — CID 3741602
2-chloro-N-(2,5-dimethylpyrazol-3-yl)benzamide (PubChem CID 3741602) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dimethylpyrazol-3-yl)benzamide.
| Compound Name | 2-chloro-N-(2,5-dimethylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 3741602 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-chloro-N-(2,5-dimethylpyrazol-3-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2Cl)n(C)n1 |
| InChI | InChI=1S/C12H12ClN3O/c1-8-7-11(16(2)15-8)14-12(17)9-5-3-4-6-10(9)13/h3-7H,1-2H3,(H,14,17) |
| InChIKey | XVFATBUWZUYFCL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |