About indole-1-carboxylic acid
indole-1-carboxylic acid (PubChem CID 3741802) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is indole-1-carboxylic acid.
Molecular Properties
| Compound Name | indole-1-carboxylic acid |
| PubChem CID | 3741802 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | indole-1-carboxylic acid |
| SMILES | O=C(O)n1ccc2ccccc21 |
| InChI | InChI=1S/C9H7NO2/c11-9(12)10-6-5-7-3-1-2-4-8(7)10/h1-6H,(H,11,12) |
| InChIKey | UTWGRMYWDUMKNY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indole-1-carboxylic acid?
The IUPAC name of indole-1-carboxylic acid (CID 3741802) is indole-1-carboxylic acid.
What is the SMILES notation for indole-1-carboxylic acid?
The canonical SMILES for indole-1-carboxylic acid is O=C(O)n1ccc2ccccc21.
What is the InChIKey of indole-1-carboxylic acid?
The InChIKey is UTWGRMYWDUMKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c11-9(12)10-6-5-7-3-1-2-4-8(7)10/h1-6H,(H,11,12).
What are the key properties of indole-1-carboxylic acid?
indole-1-carboxylic acid has a molecular weight of 161.16 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indole-1-carboxylic acid is sourced from PubChem (CID 3741802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).