C22H29N5O3S2 — CID 3742279
3-[(4,4-dimethyl-15-methylsulfanyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propan-1-ol (PubChem CID 3742279) has the molecular formula C22H29N5O3S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-15-methylsulfanyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propan-1-ol.
| Compound Name | 3-[(4,4-dimethyl-15-methylsulfanyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 3742279 |
| Molecular Formula | C22H29N5O3S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-[(4,4-dimethyl-15-methylsulfanyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propan-1-ol |
| SMILES | CSc1nc(NCCCO)c2sc3nc(N4CCOCC4)c4c(c3c2n1)CC(C)(C)OC4 |
| InChI | InChI=1S/C22H29N5O3S2/c1-22(2)11-13-14(12-30-22)19(27-6-9-29-10-7-27)26-20-15(13)16-17(32-20)18(23-5-4-8-28)25-21(24-16)31-3/h28H,4-12H2,1-3H3,(H,23,24,25) |
| InChIKey | XFWMKKFCIHBIDD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|