About (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone
(7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone (PubChem CID 3742453) has the molecular formula C26H28N2O
and a molecular weight of 384.52 g/mol. Its IUPAC name is (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone |
| PubChem CID | 3742453 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2c3cc(N)ccc3C(C)(c3ccccc3)CC2(C)C)cc1 |
| InChI | InChI=1S/C26H28N2O/c1-18-10-12-19(13-11-18)24(29)28-23-16-21(27)14-15-22(23)26(4,17-25(28,2)3)20-8-6-5-7-9-20/h5-16H,17,27H2,1-4H3 |
| InChIKey | SSJVFGGOLUILQN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone?
The IUPAC name of (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone (CID 3742453) is (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone.
What is the SMILES notation for (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone?
The canonical SMILES for (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone is Cc1ccc(C(=O)N2c3cc(N)ccc3C(C)(c3ccccc3)CC2(C)C)cc1.
What is the InChIKey of (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone?
The InChIKey is SSJVFGGOLUILQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O/c1-18-10-12-19(13-11-18)24(29)28-23-16-21(27)14-15-22(23)26(4,17-25(28,2)3)20-8-6-5-7-9-20/h5-16H,17,27H2,1-4H3.
What are the key properties of (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone?
(7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone has a molecular weight of 384.52 g/mol, XLogP of 5.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)-(4-methylphenyl)methanone is sourced from PubChem (CID 3742453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).