About ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate
ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 3742475) has the molecular formula C12H10N2O4S
and a molecular weight of 278.29 g/mol. Its IUPAC name is ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 3742475 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C12H10N2O4S/c1-2-18-12(15)10-7-19-11(13-10)8-3-5-9(6-4-8)14(16)17/h3-7H,2H2,1H3 |
| InChIKey | XQBNPFPSRBLFHV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate (CID 3742475) is ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(-c2ccc([N+](=O)[O-])cc2)n1.
What is the InChIKey of ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is XQBNPFPSRBLFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O4S/c1-2-18-12(15)10-7-19-11(13-10)8-3-5-9(6-4-8)14(16)17/h3-7H,2H2,1H3.
What are the key properties of ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate?
ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 278.29 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 3742475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).