C17H23N5OS — CID 3742604
14,14-dimethyl-N-pentyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine (PubChem CID 3742604) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 14,14-dimethyl-N-pentyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine.
| Compound Name | 14,14-dimethyl-N-pentyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
|---|---|
| PubChem CID | 3742604 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 14,14-dimethyl-N-pentyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
| SMILES | CCCCCNc1nc2sc3c(c2c2ncnn12)CC(C)(C)OC3 |
| InChI | InChI=1S/C17H23N5OS/c1-4-5-6-7-18-16-21-15-13(14-19-10-20-22(14)16)11-8-17(2,3)23-9-12(11)24-15/h10H,4-9H2,1-3H3,(H,18,21) |
| InChIKey | MRHMBIJEWOHCQN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|