C20H17ClN4O6 — CID 3743235
1-(4-chloro-3-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3743235) has the molecular formula C20H17ClN4O6 and a molecular weight of 444.83 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3743235 |
| Molecular Formula | C20H17ClN4O6 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1NC(c2ccc(Cl)c([N+](=O)[O-])c2)C2C(=O)N(CCc3ccccn3)C(=O)C12 |
| InChI | InChI=1S/C20H17ClN4O6/c21-12-5-4-10(9-13(12)25(30)31)16-14-15(17(23-16)20(28)29)19(27)24(18(14)26)8-6-11-3-1-2-7-22-11/h1-5,7,9,14-17,23H,6,8H2,(H,28,29) |
| InChIKey | SGBSIUFQPVWURK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 142.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|