C13H10Cl4O5 — CID 3743305
1,9,10,11-tetrachloro-12,12-dimethoxy-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-ene-3,7-dione (PubChem CID 3743305) has the molecular formula C13H10Cl4O5 and a molecular weight of 388.03 g/mol. Its IUPAC name is 1,9,10,11-tetrachloro-12,12-dimethoxy-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-ene-3,7-dione.
| Compound Name | 1,9,10,11-tetrachloro-12,12-dimethoxy-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-ene-3,7-dione |
|---|---|
| PubChem CID | 3743305 |
| Molecular Formula | C13H10Cl4O5 |
| Molecular Weight | 388.03 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 1,9,10,11-tetrachloro-12,12-dimethoxy-5-oxatetracyclo[7.2.1.02,8.04,6]dodec-10-ene-3,7-dione |
| SMILES | COC1(OC)C2(Cl)C(Cl)=C(Cl)C1(Cl)C1C(=O)C3OC3C(=O)C12 |
| InChI | InChI=1S/C13H10Cl4O5/c1-20-13(21-2)11(16)3-4(12(13,17)10(15)9(11)14)6(19)8-7(22-8)5(3)18/h3-4,7-8H,1-2H3 |
| InChIKey | FTFODMXPWPXCFN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.03 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|