C21H23Cl2N3O4 — CID 37445813
2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 37445813) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 37445813 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-29-15-4-6-18(19(12-15)30-2)24-20(27)13-25-7-9-26(10-8-25)21(28)16-5-3-14(22)11-17(16)23/h3-6,11-12H,7-10,13H2,1-2H3,(H,24,27) |
| InChIKey | HFBUUTCZWUBHTQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |