C10H24N2S2+2 — CID 3745088
2-[5-(2-sulfaniumylethyl)-1,5-diazocan-1-yl]ethylsulfanium (PubChem CID 3745088) has the molecular formula C10H24N2S2+2 and a molecular weight of 236.45 g/mol. Its IUPAC name is 2-[5-(2-sulfaniumylethyl)-1,5-diazocan-1-yl]ethylsulfanium.
| Compound Name | 2-[5-(2-sulfaniumylethyl)-1,5-diazocan-1-yl]ethylsulfanium |
|---|---|
| PubChem CID | 3745088 |
| Molecular Formula | C10H24N2S2+2 |
| Molecular Weight | 236.45 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-[5-(2-sulfaniumylethyl)-1,5-diazocan-1-yl]ethylsulfanium |
| SMILES | [SH2+]CCN1CCCN(CC[SH2+])CCC1 |
| InChI | InChI=1S/C10H22N2S2/c13-9-7-11-3-1-4-12(8-10-14)6-2-5-11/h13-14H,1-10H2/p+2 |
| InChIKey | WSOOQVLSFOUZDD-UHFFFAOYSA-P |
| XLogP | -0.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.45 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|