C20H12O — CID 37455
6b,7a-Dihydrobenzo(10,11)chryseno(1,2-b)oxirene (PubChem CID 37455) has the molecular formula C20H12O and a molecular weight of 268.30 g/mol. Its IUPAC name is 6-oxahexacyclo[11.6.2.02,8.05,7.010,20.017,21]henicosa-1(20),2(8),3,9,11,13(21),14,16,18-nonaene.
| Compound Name | 6b,7a-Dihydrobenzo(10,11)chryseno(1,2-b)oxirene |
|---|---|
| PubChem CID | 37455 |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 6-oxahexacyclo[11.6.2.02,8.05,7.010,20.017,21]henicosa-1(20),2(8),3,9,11,13(21),14,16,18-nonaene |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC5=C4C=CC6C5O6)C=C2 |
| InChI | InChI=1S/C20H12O/c1-2-11-4-5-13-10-16-14(8-9-17-20(16)21-17)15-7-6-12(3-1)18(11)19(13)15/h1-10,17,20H |
| InChIKey | OLLMQFHYRYHKTD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | 482 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|