C18H22N4 — CID 3746157
5-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 3746157) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 3746157 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCNc1cc(C)nc2c(-c3ccccc3)cnn12 |
| InChI | InChI=1S/C18H22N4/c1-3-4-8-11-19-17-12-14(2)21-18-16(13-20-22(17)18)15-9-6-5-7-10-15/h5-7,9-10,12-13,19H,3-4,8,11H2,1-2H3 |
| InChIKey | SBYIUYXYQMXWEB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|