About butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate
butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate (PubChem CID 3746231) has the molecular formula C18H17ClN4O3
and a molecular weight of 372.81 g/mol. Its IUPAC name is butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate.
Molecular Properties
| Compound Name | butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
| PubChem CID | 3746231 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1cc(-c2ccc(C=Nn3cnnc3)o2)ccc1Cl |
| InChI | InChI=1S/C18H17ClN4O3/c1-2-3-8-25-18(24)15-9-13(4-6-16(15)19)17-7-5-14(26-17)10-22-23-11-20-21-12-23/h4-7,9-12H,2-3,8H2,1H3 |
| InChIKey | GIAVHQMVBSARBR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
The IUPAC name of butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate (CID 3746231) is butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate.
What is the SMILES notation for butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
The canonical SMILES for butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate is CCCCOC(=O)c1cc(-c2ccc(C=Nn3cnnc3)o2)ccc1Cl.
What is the InChIKey of butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
The InChIKey is GIAVHQMVBSARBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN4O3/c1-2-3-8-25-18(24)15-9-13(4-6-16(15)19)17-7-5-14(26-17)10-22-23-11-20-21-12-23/h4-7,9-12H,2-3,8H2,1H3.
What are the key properties of butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate has a molecular weight of 372.81 g/mol, XLogP of 4.03, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-chloro-5-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate is sourced from PubChem (CID 3746231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).