C18H23ClN3O3S+ — CID 3746411
2-[(4-chlorophenyl)sulfonylamino]ethyl-[1-(3-methoxyanilino)ethylidene]-methylazanium (PubChem CID 3746411) has the molecular formula C18H23ClN3O3S+ and a molecular weight of 396.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]ethyl-[1-(3-methoxyanilino)ethylidene]-methylazanium.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]ethyl-[1-(3-methoxyanilino)ethylidene]-methylazanium |
|---|---|
| PubChem CID | 3746411 |
| Molecular Formula | C18H23ClN3O3S+ |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]ethyl-[1-(3-methoxyanilino)ethylidene]-methylazanium |
| SMILES | COc1cccc(N/C(C)=[N+](\C)CCNS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-14(21-16-5-4-6-17(13-16)25-3)22(2)12-11-20-26(23,24)18-9-7-15(19)8-10-18/h4-10,13,20H,11-12H2,1-3H3/p+1 |
| InChIKey | URSYVFXHAXNGEX-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|