C21H20N2O2 — CID 3746661
2-ethyl-8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene (PubChem CID 3746661) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-ethyl-8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene.
| Compound Name | 2-ethyl-8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene |
|---|---|
| PubChem CID | 3746661 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-ethyl-8-methoxy-4-(4-methoxyphenyl)-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene |
| SMILES | CCN1N=C(c2ccc(OC)cc2)c2ccc(OC)c3cccc1c23 |
| InChI | InChI=1S/C21H20N2O2/c1-4-23-18-7-5-6-16-19(25-3)13-12-17(20(16)18)21(22-23)14-8-10-15(24-2)11-9-14/h5-13H,4H2,1-3H3 |
| InChIKey | ROTYKDMSHYKCOU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |