C21H25N3O3 — CID 3746825
1-cyclohexyl-5-[N-(2,3-dihydro-1H-inden-5-yl)-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3746825) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-cyclohexyl-5-[N-(2,3-dihydro-1H-inden-5-yl)-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-cyclohexyl-5-[N-(2,3-dihydro-1H-inden-5-yl)-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3746825 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-cyclohexyl-5-[N-(2,3-dihydro-1H-inden-5-yl)-C-methylcarbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | C/C(=N\c1ccc2c(c1)CCC2)c1c(O)n(C2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H25N3O3/c1-13(22-16-11-10-14-6-5-7-15(14)12-16)18-19(25)23-21(27)24(20(18)26)17-8-3-2-4-9-17/h10-12,17,26H,2-9H2,1H3,(H,23,25,27)/b22-13+ |
| InChIKey | NQKOQLUGNYUNBO-LPYMAVHISA-N |
| XLogP | 3.38 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|