C22H32N4O5 — CID 3746828
5-[3-(diethylamino)propyliminomethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3746828) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-[3-(diethylamino)propyliminomethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[3-(diethylamino)propyliminomethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3746828 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 5-[3-(diethylamino)propyliminomethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN(CC)CCC/N=C/c1c(O)n(CCc2ccc(OC)c(OC)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H32N4O5/c1-5-25(6-2)12-7-11-23-15-17-20(27)24-22(29)26(21(17)28)13-10-16-8-9-18(30-3)19(14-16)31-4/h8-9,14-15,28H,5-7,10-13H2,1-4H3,(H,24,27,29)/b23-15+ |
| InChIKey | HZMALUVXADIDCD-HZHRSRAPSA-N |
| XLogP | 1.65 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|