C16H26Cl2N2O8S2 — CID 3747571
(4-chloro-1,1-dioxothiolan-3-yl) N-[6-[(4-chloro-1,1-dioxothiolan-3-yl)oxycarbonylamino]hexyl]carbamate (PubChem CID 3747571) has the molecular formula C16H26Cl2N2O8S2 and a molecular weight of 509.43 g/mol. Its IUPAC name is (4-chloro-1,1-dioxothiolan-3-yl) N-[6-[(4-chloro-1,1-dioxothiolan-3-yl)oxycarbonylamino]hexyl]carbamate.
| Compound Name | (4-chloro-1,1-dioxothiolan-3-yl) N-[6-[(4-chloro-1,1-dioxothiolan-3-yl)oxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 3747571 |
| Molecular Formula | C16H26Cl2N2O8S2 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | (4-chloro-1,1-dioxothiolan-3-yl) N-[6-[(4-chloro-1,1-dioxothiolan-3-yl)oxycarbonylamino]hexyl]carbamate |
| SMILES | O=C(NCCCCCCNC(=O)OC1CS(=O)(=O)CC1Cl)OC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C16H26Cl2N2O8S2/c17-11-7-29(23,24)9-13(11)27-15(21)19-5-3-1-2-4-6-20-16(22)28-14-10-30(25,26)8-12(14)18/h11-14H,1-10H2,(H,19,21)(H,20,22) |
| InChIKey | JCEBBZXUKSUEDW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|