C18H22N2O2 — CID 3747777
1-[2-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]pyrazolidin-1-yl]but-2-en-1-one (PubChem CID 3747777) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[2-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]pyrazolidin-1-yl]but-2-en-1-one.
| Compound Name | 1-[2-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]pyrazolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 3747777 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-[2-[2-(2,3-dihydro-1H-inden-2-yl)acetyl]pyrazolidin-1-yl]but-2-en-1-one |
| SMILES | CC=CC(=O)N1CCCN1C(=O)CC1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H22N2O2/c1-2-6-17(21)19-9-5-10-20(19)18(22)13-14-11-15-7-3-4-8-16(15)12-14/h2-4,6-8,14H,5,9-13H2,1H3 |
| InChIKey | XFAHLHRJSKBABK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|