C22H30N4O2S2 — CID 3747807
[2-[4-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 3747807) has the molecular formula C22H30N4O2S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is [2-[4-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-[4-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3747807 |
| Molecular Formula | C22H30N4O2S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [2-[4-[3-(3,6-dihydro-2H-pyridine-1-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | Cc1ccc(C(=O)N2CC=CCC2)c(C2CCN(C(=O)CSC(=S)N(C)C)CC2)n1 |
| InChI | InChI=1S/C22H30N4O2S2/c1-16-7-8-18(21(28)26-11-5-4-6-12-26)20(23-16)17-9-13-25(14-10-17)19(27)15-30-22(29)24(2)3/h4-5,7-8,17H,6,9-15H2,1-3H3 |
| InChIKey | APCXAKGCOGFZHG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|