C14H13F2NO3S — CID 37478597
3-fluoro-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide (PubChem CID 37478597) has the molecular formula C14H13F2NO3S and a molecular weight of 313.33 g/mol. Its IUPAC name is 3-fluoro-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-fluoro-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 37478597 |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-fluoro-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C14H13F2NO3S/c1-20-14-7-6-12(8-13(14)16)21(18,19)17-9-10-2-4-11(15)5-3-10/h2-8,17H,9H2,1H3 |
| InChIKey | HIVQNKHPTGRLQW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |