C21H29BN4 — CID 3748170
6-methyl-N,3-diphenyl-2,2-dipropyl-1,5-diaza-3-azonia-2-boranuidacyclohexa-3,6-dien-4-amine (PubChem CID 3748170) has the molecular formula C21H29BN4 and a molecular weight of 348.30 g/mol. Its IUPAC name is 6-methyl-N,3-diphenyl-2,2-dipropyl-1,5-diaza-3-azonia-2-boranuidacyclohexa-3,6-dien-4-amine.
| Compound Name | 6-methyl-N,3-diphenyl-2,2-dipropyl-1,5-diaza-3-azonia-2-boranuidacyclohexa-3,6-dien-4-amine |
|---|---|
| PubChem CID | 3748170 |
| Molecular Formula | C21H29BN4 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 6-methyl-N,3-diphenyl-2,2-dipropyl-1,5-diaza-3-azonia-2-boranuidacyclohexa-3,6-dien-4-amine |
| SMILES | CCC[B-]1(CCC)N=C(C)NC(Nc2ccccc2)=[N+]1c1ccccc1 |
| InChI | InChI=1S/C21H29BN4/c1-4-16-22(17-5-2)25-18(3)23-21(24-19-12-8-6-9-13-19)26(22)20-14-10-7-11-15-20/h6-15,24H,4-5,16-17H2,1-3H3,(H,23,25) |
| InChIKey | STOHKLIFCHZXHT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 39.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|