About 1-ethyl-3-hexylthiourea
1-ethyl-3-hexylthiourea (PubChem CID 3748494) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is 1-ethyl-3-hexylthiourea.
Molecular Properties
| Compound Name | 1-ethyl-3-hexylthiourea |
| PubChem CID | 3748494 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-ethyl-3-hexylthiourea |
| SMILES | CCCCCCNC(=S)NCC |
| InChI | InChI=1S/C9H20N2S/c1-3-5-6-7-8-11-9(12)10-4-2/h3-8H2,1-2H3,(H2,10,11,12) |
| InChIKey | NCAYZJZYJMBCSD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-hexylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-hexylthiourea?
The IUPAC name of 1-ethyl-3-hexylthiourea (CID 3748494) is 1-ethyl-3-hexylthiourea.
What is the SMILES notation for 1-ethyl-3-hexylthiourea?
The canonical SMILES for 1-ethyl-3-hexylthiourea is CCCCCCNC(=S)NCC.
What is the InChIKey of 1-ethyl-3-hexylthiourea?
The InChIKey is NCAYZJZYJMBCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2S/c1-3-5-6-7-8-11-9(12)10-4-2/h3-8H2,1-2H3,(H2,10,11,12).
What are the key properties of 1-ethyl-3-hexylthiourea?
1-ethyl-3-hexylthiourea has a molecular weight of 188.34 g/mol, XLogP of 2.05, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-hexylthiourea is sourced from PubChem (CID 3748494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).