C19H15ClF3N3O3 — CID 3748507
4-chloro-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 3748507) has the molecular formula C19H15ClF3N3O3 and a molecular weight of 425.79 g/mol. Its IUPAC name is 4-chloro-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | 4-chloro-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 3748507 |
| Molecular Formula | C19H15ClF3N3O3 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-chloro-N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | Cc1ccc(N2C(=O)NC(NC(=O)c3ccc(Cl)cc3)(C(F)(F)F)C2=O)cc1C |
| InChI | InChI=1S/C19H15ClF3N3O3/c1-10-3-8-14(9-11(10)2)26-16(28)18(19(21,22)23,25-17(26)29)24-15(27)12-4-6-13(20)7-5-12/h3-9H,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | VZPBVPGWLMJGJU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|