C4H2N3O4- — CID 3748774
4,6-dioxo-1H-1,3,5-triazine-2-carboxylate (PubChem CID 3748774) has the molecular formula C4H2N3O4- and a molecular weight of 156.08 g/mol. Its IUPAC name is 4,6-dioxo-1H-1,3,5-triazine-2-carboxylate.
| Compound Name | 4,6-dioxo-1H-1,3,5-triazine-2-carboxylate |
|---|---|
| PubChem CID | 3748774 |
| Molecular Formula | C4H2N3O4- |
| Molecular Weight | 156.08 g/mol |
| Exact Mass | 156.01 |
| IUPAC Name | 4,6-dioxo-1H-1,3,5-triazine-2-carboxylate |
| SMILES | O=C([O-])c1nc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H3N3O4/c8-2(9)1-5-3(10)7-4(11)6-1/h(H,8,9)(H2,5,6,7,10,11)/p-1 |
| InChIKey | RYYCJUAHISIHTL-UHFFFAOYSA-M |
| XLogP | -3.18 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.08 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |