C24H29N3O3 — CID 3749033
2-methoxy-4-(1'-propan-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine]-2-yl)phenol (PubChem CID 3749033) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-methoxy-4-(1'-propan-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine]-2-yl)phenol.
| Compound Name | 2-methoxy-4-(1'-propan-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine]-2-yl)phenol |
|---|---|
| PubChem CID | 3749033 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-methoxy-4-(1'-propan-2-ylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-piperidine]-2-yl)phenol |
| SMILES | COc1cc(C2=NN3C(C2)c2ccccc2OC32CCN(C(C)C)CC2)ccc1O |
| InChI | InChI=1S/C24H29N3O3/c1-16(2)26-12-10-24(11-13-26)27-20(18-6-4-5-7-22(18)30-24)15-19(25-27)17-8-9-21(28)23(14-17)29-3/h4-9,14,16,20,28H,10-13,15H2,1-3H3 |
| InChIKey | PDNPJICNZWAMBS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|