C19H25FN2O3S — CID 3749054
5-(dibutyl-λ4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 3749054) has the molecular formula C19H25FN2O3S and a molecular weight of 380.49 g/mol. Its IUPAC name is 5-(dibutyl-λ4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(dibutyl-λ4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3749054 |
| Molecular Formula | C19H25FN2O3S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5-(dibutyl-λ4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCS(CCCC)=C1C(=O)NC(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H25FN2O3S/c1-3-5-11-26(12-6-4-2)16-17(23)21-19(25)22(18(16)24)13-14-7-9-15(20)10-8-14/h7-10H,3-6,11-13H2,1-2H3,(H,21,23,25) |
| InChIKey | RMSFXWBCYKPLTO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|