C23H24N4O3 — CID 3749102
9-(4-butoxyphenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile (PubChem CID 3749102) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 9-(4-butoxyphenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile.
| Compound Name | 9-(4-butoxyphenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
|---|---|
| PubChem CID | 3749102 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 9-(4-butoxyphenyl)-12-imino-10,11-dioxatricyclo[6.2.2.01,6]dodecane-7,7,8-tricarbonitrile |
| SMILES | [H]/N=C1\OC23CCCCC2C(C#N)(C#N)C1(C#N)C(c1ccc(OCCCC)cc1)O3 |
| InChI | InChI=1S/C23H24N4O3/c1-2-3-12-28-17-9-7-16(8-10-17)19-22(15-26)20(27)30-23(29-19)11-5-4-6-18(23)21(22,13-24)14-25/h7-10,18-19,27H,2-6,11-12H2,1H3/b27-20- |
| InChIKey | YYPIXZMSBXDHKL-OOAXWGSJSA-N |
| XLogP | 4.37 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|