About 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine
2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine (PubChem CID 3749180) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine |
| PubChem CID | 3749180 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine |
| SMILES | CCCc1c(C)nn(-c2ncccc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H16N4O2/c1-4-6-11-9(2)15-16(10(11)3)13-12(17(18)19)7-5-8-14-13/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | LSMZUMQAGVVVMH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine?
The IUPAC name of 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine (CID 3749180) is 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine.
What is the SMILES notation for 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine?
The canonical SMILES for 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine is CCCc1c(C)nn(-c2ncccc2[N+](=O)[O-])c1C.
What is the InChIKey of 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine?
The InChIKey is LSMZUMQAGVVVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-4-6-11-9(2)15-16(10(11)3)13-12(17(18)19)7-5-8-14-13/h5,7-8H,4,6H2,1-3H3.
What are the key properties of 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine?
2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine has a molecular weight of 260.30 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine is sourced from PubChem (CID 3749180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).