C13H16N4O2 — CID 3749180
2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine (PubChem CID 3749180) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine.
| Compound Name | 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine |
|---|---|
| PubChem CID | 3749180 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(3,5-dimethyl-4-propylpyrazol-1-yl)-3-nitropyridine |
| SMILES | CCCc1c(C)nn(-c2ncccc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H16N4O2/c1-4-6-11-9(2)15-16(10(11)3)13-12(17(18)19)7-5-8-14-13/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | LSMZUMQAGVVVMH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|