About ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate
ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate (PubChem CID 3749252) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate |
| PubChem CID | 3749252 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate |
| SMILES | CCOC(=O)C1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C11H11NO3S/c1-2-15-11(14)9-10(13)12-7-5-3-4-6-8(7)16-9/h3-6,9H,2H2,1H3,(H,12,13) |
| InChIKey | JTPWXHVRRAHTHX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate?
The IUPAC name of ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate (CID 3749252) is ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate.
What is the SMILES notation for ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate?
The canonical SMILES for ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate is CCOC(=O)C1Sc2ccccc2NC1=O.
What is the InChIKey of ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate?
The InChIKey is JTPWXHVRRAHTHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-2-15-11(14)9-10(13)12-7-5-3-4-6-8(7)16-9/h3-6,9H,2H2,1H3,(H,12,13).
What are the key properties of ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate?
ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate has a molecular weight of 237.28 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxo-4H-1,4-benzothiazine-2-carboxylate is sourced from PubChem (CID 3749252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).