About 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one
2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one (PubChem CID 3749483) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one |
| PubChem CID | 3749483 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one |
| SMILES | CC(=O)C1C(=O)CC(C)(O)C(C(C)=O)C1C |
| InChI | InChI=1S/C12H18O4/c1-6-10(7(2)13)9(15)5-12(4,16)11(6)8(3)14/h6,10-11,16H,5H2,1-4H3 |
| InChIKey | OOUZLCNCRMFCPD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one?
The IUPAC name of 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one (CID 3749483) is 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one.
What is the SMILES notation for 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one?
The canonical SMILES for 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one is CC(=O)C1C(=O)CC(C)(O)C(C(C)=O)C1C.
What is the InChIKey of 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one?
The InChIKey is OOUZLCNCRMFCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-6-10(7(2)13)9(15)5-12(4,16)11(6)8(3)14/h6,10-11,16H,5H2,1-4H3.
What are the key properties of 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one?
2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one has a molecular weight of 226.27 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diacetyl-5-hydroxy-3,5-dimethylcyclohexan-1-one is sourced from PubChem (CID 3749483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).