About N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide
N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 3749974) has the molecular formula C11H11ClN2O4
and a molecular weight of 270.67 g/mol. Its IUPAC name is N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
Molecular Properties
| Compound Name | N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| PubChem CID | 3749974 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(CCl)NNC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C11H11ClN2O4/c12-5-10(15)13-14-11(16)9-6-17-7-3-1-2-4-8(7)18-9/h1-4,9H,5-6H2,(H,13,15)(H,14,16) |
| InChIKey | IGMNAYRFVQTWFZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide?
The IUPAC name of N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (CID 3749974) is N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
What is the SMILES notation for N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide?
The canonical SMILES for N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide is O=C(CCl)NNC(=O)C1COc2ccccc2O1.
What is the InChIKey of N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide?
The InChIKey is IGMNAYRFVQTWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O4/c12-5-10(15)13-14-11(16)9-6-17-7-3-1-2-4-8(7)18-9/h1-4,9H,5-6H2,(H,13,15)(H,14,16).
What are the key properties of N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide?
N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide has a molecular weight of 270.67 g/mol, XLogP of 0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-chloroacetyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide is sourced from PubChem (CID 3749974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).