About 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol
4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 3750287) has the molecular formula C12H22N2O6S2
and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| PubChem CID | 3750287 |
| Molecular Formula | C12H22N2O6S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(N2CCN(C3CS(=O)(=O)CC3O)CC2)C1 |
| InChI | InChI=1S/C12H22N2O6S2/c15-11-7-21(17,18)5-9(11)13-1-2-14(4-3-13)10-6-22(19,20)8-12(10)16/h9-12,15-16H,1-8H2 |
| InChIKey | XEZHKJKLCWAOKY-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (CID 3750287) is 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol is O=S1(=O)CC(O)C(N2CCN(C3CS(=O)(=O)CC3O)CC2)C1.
What is the InChIKey of 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
The InChIKey is XEZHKJKLCWAOKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O6S2/c15-11-7-21(17,18)5-9(11)13-1-2-14(4-3-13)10-6-22(19,20)8-12(10)16/h9-12,15-16H,1-8H2.
What are the key properties of 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol has a molecular weight of 354.45 g/mol, XLogP of -3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 3750287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).