C17H13Cl2NO — CID 3750935
2-(2,5-dichlorophenyl)-5,7-dimethyl-1H-indole-3-carbaldehyde (PubChem CID 3750935) has the molecular formula C17H13Cl2NO and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-5,7-dimethyl-1H-indole-3-carbaldehyde.
| Compound Name | 2-(2,5-dichlorophenyl)-5,7-dimethyl-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 3750935 |
| Molecular Formula | C17H13Cl2NO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-5,7-dimethyl-1H-indole-3-carbaldehyde |
| SMILES | Cc1cc(C)c2[nH]c(-c3cc(Cl)ccc3Cl)c(C=O)c2c1 |
| InChI | InChI=1S/C17H13Cl2NO/c1-9-5-10(2)16-12(6-9)14(8-21)17(20-16)13-7-11(18)3-4-15(13)19/h3-8,20H,1-2H3 |
| InChIKey | NADWCNYSNUDXPH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|