About 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde
2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde (PubChem CID 3750993) has the molecular formula C23H19NO
and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde |
| PubChem CID | 3750993 |
| Molecular Formula | C23H19NO |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde |
| SMILES | CCc1ccc2cc(-c3ccc4c5c(cccc35)CC4)c(C=O)n2c1 |
| InChI | InChI=1S/C23H19NO/c1-2-15-6-10-18-12-21(22(14-25)24(18)13-15)19-11-9-17-8-7-16-4-3-5-20(19)23(16)17/h3-6,9-14H,2,7-8H2,1H3 |
| InChIKey | VJNKWMMKQSOCJH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde?
The IUPAC name of 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde (CID 3750993) is 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde.
What is the SMILES notation for 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde?
The canonical SMILES for 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde is CCc1ccc2cc(-c3ccc4c5c(cccc35)CC4)c(C=O)n2c1.
What is the InChIKey of 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde?
The InChIKey is VJNKWMMKQSOCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO/c1-2-15-6-10-18-12-21(22(14-25)24(18)13-15)19-11-9-17-8-7-16-4-3-5-20(19)23(16)17/h3-6,9-14H,2,7-8H2,1H3.
What are the key properties of 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde?
2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde has a molecular weight of 325.41 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydroacenaphthylen-5-yl)-6-ethylindolizine-3-carbaldehyde is sourced from PubChem (CID 3750993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).