C28H41N3OS — CID 3751498
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-aminobutyl)-1,3-thiazole-4-carboxamide (PubChem CID 3751498) has the molecular formula C28H41N3OS and a molecular weight of 467.72 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-aminobutyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-aminobutyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3751498 |
| Molecular Formula | C28H41N3OS |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-aminobutyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCC(N)c1nc(C(=O)NCC2(C)CCCC3(C)c4ccc(C(C)C)cc4CCC23)cs1 |
| InChI | InChI=1S/C28H41N3OS/c1-6-8-22(29)26-31-23(16-33-26)25(32)30-17-27(4)13-7-14-28(5)21-11-9-19(18(2)3)15-20(21)10-12-24(27)28/h9,11,15-16,18,22,24H,6-8,10,12-14,17,29H2,1-5H3,(H,30,32) |
| InChIKey | QSQULWBYZOCKOA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |