C27H28FN5O2S2 — CID 3751728
3-butyl-5-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3751728) has the molecular formula C27H28FN5O2S2 and a molecular weight of 537.69 g/mol. Its IUPAC name is 3-butyl-5-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-butyl-5-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3751728 |
| Molecular Formula | C27H28FN5O2S2 |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 3-butyl-5-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=Cc2c(N3CCN(c4ccccc4F)CC3)nc3ccc(C)cn3c2=O)SC1=S |
| InChI | InChI=1S/C27H28FN5O2S2/c1-3-4-11-32-26(35)22(37-27(32)36)16-19-24(29-23-10-9-18(2)17-33(23)25(19)34)31-14-12-30(13-15-31)21-8-6-5-7-20(21)28/h5-10,16-17H,3-4,11-15H2,1-2H3 |
| InChIKey | PIHNCBFOCBRYHK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|