C17H23N3O2S — CID 3751938
ethyl 2-(2-methylprop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 3751938) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is ethyl 2-(2-methylprop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(2-methylprop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 3751938 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | ethyl 2-(2-methylprop-2-enylcarbamothioylamino)-5,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | C=C(C)CNC(=S)Nc1nc2c(cc1C(=O)OCC)CCCC2 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-22-16(21)13-9-12-7-5-6-8-14(12)19-15(13)20-17(23)18-10-11(2)3/h9H,2,4-8,10H2,1,3H3,(H2,18,19,20,23) |
| InChIKey | UAYKOODCZWRVOR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|