C17H27N3S — CID 3752656
5-(2-ethylhexyl)-1-phenyl-1,3,5-triazinane-2-thione (PubChem CID 3752656) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is 5-(2-ethylhexyl)-1-phenyl-1,3,5-triazinane-2-thione.
| Compound Name | 5-(2-ethylhexyl)-1-phenyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 3752656 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 5-(2-ethylhexyl)-1-phenyl-1,3,5-triazinane-2-thione |
| SMILES | CCCCC(CC)CN1CNC(=S)N(c2ccccc2)C1 |
| InChI | InChI=1S/C17H27N3S/c1-3-5-9-15(4-2)12-19-13-18-17(21)20(14-19)16-10-7-6-8-11-16/h6-8,10-11,15H,3-5,9,12-14H2,1-2H3,(H,18,21) |
| InChIKey | FDRLNFQPZPGUMC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|